C21H20N4Pt — CID 58163118
1-methyl-2-(3-methylbenzene-6-id-1-yl)imidazole;1-methyl-2-phenylimidazole;platinum(2+) (PubChem CID 58163118) has the molecular formula C21H20N4Pt and a molecular weight of 523.50 g/mol. Its IUPAC name is 1-methyl-2-(3-methylbenzene-6-id-1-yl)imidazole;1-methyl-2-phenylimidazole;platinum(2+).
| Compound Name | 1-methyl-2-(3-methylbenzene-6-id-1-yl)imidazole;1-methyl-2-phenylimidazole;platinum(2+) |
|---|---|
| PubChem CID | 58163118 |
| Molecular Formula | C21H20N4Pt |
| Molecular Weight | 523.50 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | 1-methyl-2-(3-methylbenzene-6-id-1-yl)imidazole;1-methyl-2-phenylimidazole;platinum(2+) |
| SMILES | Cc1cc[c-]c(-c2nccn2C)c1.Cn1ccnc1-c1[c-]cccc1.[Pt+2] |
| InChI | InChI=1S/C11H11N2.C10H9N2.Pt/c1-9-4-3-5-10(8-9)11-12-6-7-13(11)2;1-12-8-7-11-10(12)9-5-3-2-4-6-9;/h3-4,6-8H,1-2H3;2-5,7-8H,1H3;/q2*-1;+2 |
| InChIKey | WQYVCWHRHBUCNV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|