About iridium;1-methyl-2-(3-methylbenzene-6-id-1-yl)imidazole;1-methyl-2-phenylimidazole
iridium;1-methyl-2-(3-methylbenzene-6-id-1-yl)imidazole;1-methyl-2-phenylimidazole (PubChem CID 58163056) has the molecular formula C21H20IrN4-2
and a molecular weight of 520.64 g/mol. Its IUPAC name is iridium;1-methyl-2-(3-methylbenzene-6-id-1-yl)imidazole;1-methyl-2-phenylimidazole.
Molecular Properties
| Compound Name | iridium;1-methyl-2-(3-methylbenzene-6-id-1-yl)imidazole;1-methyl-2-phenylimidazole |
| PubChem CID | 58163056 |
| Molecular Formula | C21H20IrN4-2 |
| Molecular Weight | 520.64 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | iridium;1-methyl-2-(3-methylbenzene-6-id-1-yl)imidazole;1-methyl-2-phenylimidazole |
| SMILES | Cc1cc[c-]c(-c2nccn2C)c1.Cn1ccnc1-c1[c-]cccc1.[Ir] |
| InChI | InChI=1S/C11H11N2.C10H9N2.Ir/c1-9-4-3-5-10(8-9)11-12-6-7-13(11)2;1-12-8-7-11-10(12)9-5-3-2-4-6-9;/h3-4,6-8H,1-2H3;2-5,7-8H,1H3;/q2*-1; |
| InChIKey | XZQVLRLPCKHCQF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 520.64 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze iridium;1-methyl-2-(3-methylbenzene-6-id-1-yl)imidazole;1-methyl-2-phenylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;1-methyl-2-(3-methylbenzene-6-id-1-yl)imidazole;1-methyl-2-phenylimidazole?
The IUPAC name of iridium;1-methyl-2-(3-methylbenzene-6-id-1-yl)imidazole;1-methyl-2-phenylimidazole (CID 58163056) is iridium;1-methyl-2-(3-methylbenzene-6-id-1-yl)imidazole;1-methyl-2-phenylimidazole.
What is the SMILES notation for iridium;1-methyl-2-(3-methylbenzene-6-id-1-yl)imidazole;1-methyl-2-phenylimidazole?
The canonical SMILES for iridium;1-methyl-2-(3-methylbenzene-6-id-1-yl)imidazole;1-methyl-2-phenylimidazole is Cc1cc[c-]c(-c2nccn2C)c1.Cn1ccnc1-c1[c-]cccc1.[Ir].
What is the InChIKey of iridium;1-methyl-2-(3-methylbenzene-6-id-1-yl)imidazole;1-methyl-2-phenylimidazole?
The InChIKey is XZQVLRLPCKHCQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N2.C10H9N2.Ir/c1-9-4-3-5-10(8-9)11-12-6-7-13(11)2;1-12-8-7-11-10(12)9-5-3-2-4-6-9;/h3-4,6-8H,1-2H3;2-5,7-8H,1H3;/q2*-1;.
What are the key properties of iridium;1-methyl-2-(3-methylbenzene-6-id-1-yl)imidazole;1-methyl-2-phenylimidazole?
iridium;1-methyl-2-(3-methylbenzene-6-id-1-yl)imidazole;1-methyl-2-phenylimidazole has a molecular weight of 520.64 g/mol, XLogP of 4.08, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;1-methyl-2-(3-methylbenzene-6-id-1-yl)imidazole;1-methyl-2-phenylimidazole is sourced from PubChem (CID 58163056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).