C18H16IrN6-2 — CID 58220024
iridium;1-methyl-2-phenylimidazole;4-(4-methyl-1,2,4-triazol-3-yl)-3H-pyridin-3-ide (PubChem CID 58220024) has the molecular formula C18H16IrN6-2 and a molecular weight of 508.59 g/mol. Its IUPAC name is iridium;1-methyl-2-phenylimidazole;4-(4-methyl-1,2,4-triazol-3-yl)-3H-pyridin-3-ide.
| Compound Name | iridium;1-methyl-2-phenylimidazole;4-(4-methyl-1,2,4-triazol-3-yl)-3H-pyridin-3-ide |
|---|---|
| PubChem CID | 58220024 |
| Molecular Formula | C18H16IrN6-2 |
| Molecular Weight | 508.59 g/mol |
| Exact Mass | 509.11 |
| IUPAC Name | iridium;1-methyl-2-phenylimidazole;4-(4-methyl-1,2,4-triazol-3-yl)-3H-pyridin-3-ide |
| SMILES | Cn1ccnc1-c1[c-]cccc1.Cn1cnnc1-c1[c-]cncc1.[Ir] |
| InChI | InChI=1S/C10H9N2.C8H7N4.Ir/c1-12-8-7-11-10(12)9-5-3-2-4-6-9;1-12-6-10-11-8(12)7-2-4-9-5-3-7;/h2-5,7-8H,1H3;2,4-6H,1H3;/q2*-1; |
| InChIKey | UMEXUUDTPSVVAG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.59 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|