About 1-methyl-2-phenylimidazole;1-methyl-2-phenylimidazol-1-ium-3-ide;platinum
1-methyl-2-phenylimidazole;1-methyl-2-phenylimidazol-1-ium-3-ide;platinum (PubChem CID 58401739) has the molecular formula C20H18N4Pt-2
and a molecular weight of 509.47 g/mol. Its IUPAC name is 1-methyl-2-phenylimidazole;1-methyl-2-phenylimidazol-1-ium-3-ide;platinum.
Molecular Properties
| Compound Name | 1-methyl-2-phenylimidazole;1-methyl-2-phenylimidazol-1-ium-3-ide;platinum |
| PubChem CID | 58401739 |
| Molecular Formula | C20H18N4Pt-2 |
| Molecular Weight | 509.47 g/mol |
| Exact Mass | 509.12 |
| IUPAC Name | 1-methyl-2-phenylimidazole;1-methyl-2-phenylimidazol-1-ium-3-ide;platinum |
| SMILES | C[n+]1cc[n-]c1-c1[c-]cccc1.Cn1ccnc1-c1[c-]cccc1.[Pt] |
| InChI | InChI=1S/2C10H9N2.Pt/c2*1-12-8-7-11-10(12)9-5-3-2-4-6-9;/h2*2-5,7-8H,1H3;/q2*-1; |
| InChIKey | JCUPNHHFAMGWGS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 35.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 509.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2-phenylimidazole;1-methyl-2-phenylimidazol-1-ium-3-ide;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-phenylimidazole;1-methyl-2-phenylimidazol-1-ium-3-ide;platinum?
The IUPAC name of 1-methyl-2-phenylimidazole;1-methyl-2-phenylimidazol-1-ium-3-ide;platinum (CID 58401739) is 1-methyl-2-phenylimidazole;1-methyl-2-phenylimidazol-1-ium-3-ide;platinum.
What is the SMILES notation for 1-methyl-2-phenylimidazole;1-methyl-2-phenylimidazol-1-ium-3-ide;platinum?
The canonical SMILES for 1-methyl-2-phenylimidazole;1-methyl-2-phenylimidazol-1-ium-3-ide;platinum is C[n+]1cc[n-]c1-c1[c-]cccc1.Cn1ccnc1-c1[c-]cccc1.[Pt].
What is the InChIKey of 1-methyl-2-phenylimidazole;1-methyl-2-phenylimidazol-1-ium-3-ide;platinum?
The InChIKey is JCUPNHHFAMGWGS-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H9N2.Pt/c2*1-12-8-7-11-10(12)9-5-3-2-4-6-9;/h2*2-5,7-8H,1H3;/q2*-1;.
What are the key properties of 1-methyl-2-phenylimidazole;1-methyl-2-phenylimidazol-1-ium-3-ide;platinum?
1-methyl-2-phenylimidazole;1-methyl-2-phenylimidazol-1-ium-3-ide;platinum has a molecular weight of 509.47 g/mol, XLogP of 2.82, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-phenylimidazole;1-methyl-2-phenylimidazol-1-ium-3-ide;platinum is sourced from PubChem (CID 58401739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).