C21H21N4Pt+ — CID 58401579
1,4-dimethyl-2-phenyl-2H-imidazol-1-ium;1-methyl-2-phenylimidazole;platinum(2+) (PubChem CID 58401579) has the molecular formula C21H21N4Pt+ and a molecular weight of 524.51 g/mol. Its IUPAC name is 1,4-dimethyl-2-phenyl-2H-imidazol-1-ium;1-methyl-2-phenylimidazole;platinum(2+).
| Compound Name | 1,4-dimethyl-2-phenyl-2H-imidazol-1-ium;1-methyl-2-phenylimidazole;platinum(2+) |
|---|---|
| PubChem CID | 58401579 |
| Molecular Formula | C21H21N4Pt+ |
| Molecular Weight | 524.51 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | 1,4-dimethyl-2-phenyl-2H-imidazol-1-ium;1-methyl-2-phenylimidazole;platinum(2+) |
| SMILES | CC1=NC(c2[c-]cccc2)[N+](C)=C1.Cn1ccnc1-c1[c-]cccc1.[Pt+2] |
| InChI | InChI=1S/C11H12N2.C10H9N2.Pt/c1-9-8-13(2)11(12-9)10-6-4-3-5-7-10;1-12-8-7-11-10(12)9-5-3-2-4-6-9;/h3-6,8,11H,1-2H3;2-5,7-8H,1H3;/q;-1;+2 |
| InChIKey | WZYFYPACDLLNAC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 33.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|