C14H11F2N4- — CID 102401857
2-[2,4-difluoro-5-(1-methylimidazol-2-yl)benzene-6-id-1-yl]-1-methylimidazole (PubChem CID 102401857) has the molecular formula C14H11F2N4- and a molecular weight of 273.27 g/mol. Its IUPAC name is 2-[2,4-difluoro-5-(1-methylimidazol-2-yl)benzene-6-id-1-yl]-1-methylimidazole.
| Compound Name | 2-[2,4-difluoro-5-(1-methylimidazol-2-yl)benzene-6-id-1-yl]-1-methylimidazole |
|---|---|
| PubChem CID | 102401857 |
| Molecular Formula | C14H11F2N4- |
| Molecular Weight | 273.27 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 2-[2,4-difluoro-5-(1-methylimidazol-2-yl)benzene-6-id-1-yl]-1-methylimidazole |
| SMILES | Cn1ccnc1-c1[c-]c(-c2nccn2C)c(F)cc1F |
| InChI | InChI=1S/C14H11F2N4/c1-19-5-3-17-13(19)9-7-10(12(16)8-11(9)15)14-18-4-6-20(14)2/h3-6,8H,1-2H3/q-1 |
| InChIKey | HUGCXQPUBUKZEE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|