C12H10F3IrN2- — CID 58202901
iridium;1-methyl-2-[3-methyl-5-(trifluoromethyl)benzene-6-id-1-yl]imidazole (PubChem CID 58202901) has the molecular formula C12H10F3IrN2- and a molecular weight of 431.44 g/mol. Its IUPAC name is iridium;1-methyl-2-[3-methyl-5-(trifluoromethyl)benzene-6-id-1-yl]imidazole.
| Compound Name | iridium;1-methyl-2-[3-methyl-5-(trifluoromethyl)benzene-6-id-1-yl]imidazole |
|---|---|
| PubChem CID | 58202901 |
| Molecular Formula | C12H10F3IrN2- |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | iridium;1-methyl-2-[3-methyl-5-(trifluoromethyl)benzene-6-id-1-yl]imidazole |
| SMILES | Cc1cc(-c2nccn2C)[c-]c(C(F)(F)F)c1.[Ir] |
| InChI | InChI=1S/C12H10F3N2.Ir/c1-8-5-9(11-16-3-4-17(11)2)7-10(6-8)12(13,14)15;/h3-6H,1-2H3;/q-1; |
| InChIKey | LODMPDOVUYIKCS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|