C14H17F3N2 — CID 142001727
1-methyl-2-[(2Z,4E,6Z)-nona-2,4,6-trien-4-yl]-4-(trifluoromethyl)imidazole (PubChem CID 142001727) has the molecular formula C14H17F3N2 and a molecular weight of 270.30 g/mol. Its IUPAC name is 1-methyl-2-[(2Z,4E,6Z)-nona-2,4,6-trien-4-yl]-4-(trifluoromethyl)imidazole.
| Compound Name | 1-methyl-2-[(2Z,4E,6Z)-nona-2,4,6-trien-4-yl]-4-(trifluoromethyl)imidazole |
|---|---|
| PubChem CID | 142001727 |
| Molecular Formula | C14H17F3N2 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 1-methyl-2-[(2Z,4E,6Z)-nona-2,4,6-trien-4-yl]-4-(trifluoromethyl)imidazole |
| SMILES | C/C=C\C(=C/C=C\CC)c1nc(C(F)(F)F)cn1C |
| InChI | InChI=1S/C14H17F3N2/c1-4-6-7-9-11(8-5-2)13-18-12(10-19(13)3)14(15,16)17/h5-10H,4H2,1-3H3/b7-6-,8-5-,11-9+ |
| InChIKey | BHJYWYDQLRIPSU-DFRNHVOSSA-N |
| XLogP | 4.36 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|