C15H21F3N2 — CID 142004720
ethane;1-methyl-2-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-4-(trifluoromethyl)imidazole (PubChem CID 142004720) has the molecular formula C15H21F3N2 and a molecular weight of 286.34 g/mol. Its IUPAC name is ethane;1-methyl-2-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-4-(trifluoromethyl)imidazole.
| Compound Name | ethane;1-methyl-2-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-4-(trifluoromethyl)imidazole |
|---|---|
| PubChem CID | 142004720 |
| Molecular Formula | C15H21F3N2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | ethane;1-methyl-2-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-4-(trifluoromethyl)imidazole |
| SMILES | C/C=C\C=C(/C=C\C)c1nc(C(F)(F)F)cn1C.CC |
| InChI | InChI=1S/C13H15F3N2.C2H6/c1-4-6-8-10(7-5-2)12-17-11(9-18(12)3)13(14,15)16;1-2/h4-9H,1-3H3;1-2H3/b6-4-,7-5-,10-8+; |
| InChIKey | OYONZTMTEPPLOR-GTIHCUCQSA-N |
| XLogP | 5.00 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|