C18H16N6Pt — CID 58401730
bis(3-(1-methylimidazol-2-yl)-4H-pyridin-4-ide);platinum(2+) (PubChem CID 58401730) has the molecular formula C18H16N6Pt and a molecular weight of 511.45 g/mol. Its IUPAC name is bis(3-(1-methylimidazol-2-yl)-4H-pyridin-4-ide);platinum(2+).
| Compound Name | bis(3-(1-methylimidazol-2-yl)-4H-pyridin-4-ide);platinum(2+) |
|---|---|
| PubChem CID | 58401730 |
| Molecular Formula | C18H16N6Pt |
| Molecular Weight | 511.45 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | bis(3-(1-methylimidazol-2-yl)-4H-pyridin-4-ide);platinum(2+) |
| SMILES | Cn1ccnc1-c1[c-]ccnc1.Cn1ccnc1-c1[c-]ccnc1.[Pt+2] |
| InChI | InChI=1S/2C9H8N3.Pt/c2*1-12-6-5-11-9(12)8-3-2-4-10-7-8;/h2*2,4-7H,1H3;/q2*-1;+2 |
| InChIKey | GIKIMDVPIUWMTD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|