C16H22FN5 — CID 142827325
N-ethyl-2-[2-[(2Z,4E)-5-fluoropenta-2,4-dienimidoyl]imidazol-1-yl]-N-methyl-N'-prop-1-en-2-ylethanimidamide (PubChem CID 142827325) has the molecular formula C16H22FN5 and a molecular weight of 303.38 g/mol. Its IUPAC name is N-ethyl-2-[2-[(2Z,4E)-5-fluoropenta-2,4-dienimidoyl]imidazol-1-yl]-N-methyl-N'-prop-1-en-2-ylethanimidamide.
| Compound Name | N-ethyl-2-[2-[(2Z,4E)-5-fluoropenta-2,4-dienimidoyl]imidazol-1-yl]-N-methyl-N'-prop-1-en-2-ylethanimidamide |
|---|---|
| PubChem CID | 142827325 |
| Molecular Formula | C16H22FN5 |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | N-ethyl-2-[2-[(2Z,4E)-5-fluoropenta-2,4-dienimidoyl]imidazol-1-yl]-N-methyl-N'-prop-1-en-2-ylethanimidamide |
| SMILES | [H]/N=C(\C=C/C=C/F)c1nccn1C/C(=N/C(=C)C)N(C)CC |
| InChI | InChI=1S/C16H22FN5/c1-5-21(4)15(20-13(2)3)12-22-11-10-19-16(22)14(18)8-6-7-9-17/h6-11,18H,2,5,12H2,1,3-4H3/b8-6-,9-7+,18-14+,20-15- |
| InChIKey | CMCMBJLGUXRQFK-XULQNMGOSA-N |
| XLogP | 3.17 |
| TPSA | 57.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|