C9H10FN3 — CID 142996659
(2E)-2-fluoro-1-(1H-imidazol-2-yl)-N-methylpenta-2,4-dien-1-imine (PubChem CID 142996659) has the molecular formula C9H10FN3 and a molecular weight of 179.20 g/mol. Its IUPAC name is (2E)-2-fluoro-1-(1H-imidazol-2-yl)-N-methylpenta-2,4-dien-1-imine.
| Compound Name | (2E)-2-fluoro-1-(1H-imidazol-2-yl)-N-methylpenta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 142996659 |
| Molecular Formula | C9H10FN3 |
| Molecular Weight | 179.20 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (2E)-2-fluoro-1-(1H-imidazol-2-yl)-N-methylpenta-2,4-dien-1-imine |
| SMILES | C=C/C=C(F)\C(=N/C)c1ncc[nH]1 |
| InChI | InChI=1S/C9H10FN3/c1-3-4-7(10)8(11-2)9-12-5-6-13-9/h3-6H,1H2,2H3,(H,12,13)/b7-4+,11-8+ |
| InChIKey | YMSYWKSXALJKDX-VCABWLAWSA-N |
| XLogP | 1.87 |
| TPSA | 41.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.20 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|