About N-[(1Z)-1-(1H-imidazol-2-yl)buta-1,3-dienyl]methanimidoyl fluoride
N-[(1Z)-1-(1H-imidazol-2-yl)buta-1,3-dienyl]methanimidoyl fluoride (PubChem CID 20811954) has the molecular formula C8H8FN3
and a molecular weight of 165.17 g/mol. Its IUPAC name is N-[(1Z)-1-(1H-imidazol-2-yl)buta-1,3-dienyl]methanimidoyl fluoride.
Molecular Properties
| Compound Name | N-[(1Z)-1-(1H-imidazol-2-yl)buta-1,3-dienyl]methanimidoyl fluoride |
| PubChem CID | 20811954 |
| Molecular Formula | C8H8FN3 |
| Molecular Weight | 165.17 g/mol |
| Exact Mass | 165.07 |
| IUPAC Name | N-[(1Z)-1-(1H-imidazol-2-yl)buta-1,3-dienyl]methanimidoyl fluoride |
| SMILES | C=C/C=C(\N=C\F)c1ncc[nH]1 |
| InChI | InChI=1S/C8H8FN3/c1-2-3-7(12-6-9)8-10-4-5-11-8/h2-6H,1H2,(H,10,11)/b7-3-,12-6+ |
| InChIKey | MHCQFVOCACULSG-GAMFOOJCSA-N |
| XLogP | 1.93 |
| TPSA | 41.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.17 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1Z)-1-(1H-imidazol-2-yl)buta-1,3-dienyl]methanimidoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1Z)-1-(1H-imidazol-2-yl)buta-1,3-dienyl]methanimidoyl fluoride?
The IUPAC name of N-[(1Z)-1-(1H-imidazol-2-yl)buta-1,3-dienyl]methanimidoyl fluoride (CID 20811954) is N-[(1Z)-1-(1H-imidazol-2-yl)buta-1,3-dienyl]methanimidoyl fluoride.
What is the SMILES notation for N-[(1Z)-1-(1H-imidazol-2-yl)buta-1,3-dienyl]methanimidoyl fluoride?
The canonical SMILES for N-[(1Z)-1-(1H-imidazol-2-yl)buta-1,3-dienyl]methanimidoyl fluoride is C=C/C=C(\N=C\F)c1ncc[nH]1.
What is the InChIKey of N-[(1Z)-1-(1H-imidazol-2-yl)buta-1,3-dienyl]methanimidoyl fluoride?
The InChIKey is MHCQFVOCACULSG-GAMFOOJCSA-N. The full InChI is InChI=1S/C8H8FN3/c1-2-3-7(12-6-9)8-10-4-5-11-8/h2-6H,1H2,(H,10,11)/b7-3-,12-6+.
What are the key properties of N-[(1Z)-1-(1H-imidazol-2-yl)buta-1,3-dienyl]methanimidoyl fluoride?
N-[(1Z)-1-(1H-imidazol-2-yl)buta-1,3-dienyl]methanimidoyl fluoride has a molecular weight of 165.17 g/mol, XLogP of 1.93, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1Z)-1-(1H-imidazol-2-yl)buta-1,3-dienyl]methanimidoyl fluoride is sourced from PubChem (CID 20811954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).