C8H8FN3 — CID 20811954
N-[(1Z)-1-(1H-imidazol-2-yl)buta-1,3-dienyl]methanimidoyl fluoride (PubChem CID 20811954) has the molecular formula C8H8FN3 and a molecular weight of 165.17 g/mol. Its IUPAC name is N-[(1Z)-1-(1H-imidazol-2-yl)buta-1,3-dienyl]methanimidoyl fluoride.
| Compound Name | N-[(1Z)-1-(1H-imidazol-2-yl)buta-1,3-dienyl]methanimidoyl fluoride |
|---|---|
| PubChem CID | 20811954 |
| Molecular Formula | C8H8FN3 |
| Molecular Weight | 165.17 g/mol |
| Exact Mass | 165.07 |
| IUPAC Name | N-[(1Z)-1-(1H-imidazol-2-yl)buta-1,3-dienyl]methanimidoyl fluoride |
| SMILES | C=C/C=C(\N=C\F)c1ncc[nH]1 |
| InChI | InChI=1S/C8H8FN3/c1-2-3-7(12-6-9)8-10-4-5-11-8/h2-6H,1H2,(H,10,11)/b7-3-,12-6+ |
| InChIKey | MHCQFVOCACULSG-GAMFOOJCSA-N |
| XLogP | 1.93 |
| TPSA | 41.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.17 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|