C23H33FN8O — CID 142996654
3-fluorobutan-2-imine;7-(imidazol-1-ylmethyl)-1-methyl-2-(nitrosomethyl)-8-propyl-8aH-[1,2,4]triazolo[1,5-c]pyrimidine;pent-1-en-4-yne (PubChem CID 142996654) has the molecular formula C23H33FN8O and a molecular weight of 456.57 g/mol. Its IUPAC name is 3-fluorobutan-2-imine;7-(imidazol-1-ylmethyl)-1-methyl-2-(nitrosomethyl)-8-propyl-8aH-[1,2,4]triazolo[1,5-c]pyrimidine;pent-1-en-4-yne.
| Compound Name | 3-fluorobutan-2-imine;7-(imidazol-1-ylmethyl)-1-methyl-2-(nitrosomethyl)-8-propyl-8aH-[1,2,4]triazolo[1,5-c]pyrimidine;pent-1-en-4-yne |
|---|---|
| PubChem CID | 142996654 |
| Molecular Formula | C23H33FN8O |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.28 |
| IUPAC Name | 3-fluorobutan-2-imine;7-(imidazol-1-ylmethyl)-1-methyl-2-(nitrosomethyl)-8-propyl-8aH-[1,2,4]triazolo[1,5-c]pyrimidine;pent-1-en-4-yne |
| SMILES | C#CCC=C.CCCC1=C(Cn2ccnc2)N=CN2N=C(CN=O)N(C)C12.[H]/N=C(\C)C(C)F |
| InChI | InChI=1S/C14H19N7O.C5H6.C4H8FN/c1-3-4-11-12(8-20-6-5-15-9-20)16-10-21-14(11)19(2)13(18-21)7-17-22;1-3-5-4-2;1-3(5)4(2)6/h5-6,9-10,14H,3-4,7-8H2,1-2H3;1,4H,2,5H2;3,6H,1-2H3/b;;6-4+ |
| InChIKey | USVYGEJHPIMVRR-DDKPUMFKSA-N |
| XLogP | 4.21 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|