C27H48FN7 — CID 142996716
N-[(1Z)-buta-1,3-dienyl]-3-fluorobutan-2-imine;ethane;N'-[6-(imidazol-1-ylmethyl)-5-propyl-4H-pyrimidin-3-yl]-2-methylpropanimidamide (PubChem CID 142996716) has the molecular formula C27H48FN7 and a molecular weight of 489.73 g/mol. Its IUPAC name is N-[(1Z)-buta-1,3-dienyl]-3-fluorobutan-2-imine;ethane;N'-[6-(imidazol-1-ylmethyl)-5-propyl-4H-pyrimidin-3-yl]-2-methylpropanimidamide.
| Compound Name | N-[(1Z)-buta-1,3-dienyl]-3-fluorobutan-2-imine;ethane;N'-[6-(imidazol-1-ylmethyl)-5-propyl-4H-pyrimidin-3-yl]-2-methylpropanimidamide |
|---|---|
| PubChem CID | 142996716 |
| Molecular Formula | C27H48FN7 |
| Molecular Weight | 489.73 g/mol |
| Exact Mass | 489.40 |
| IUPAC Name | N-[(1Z)-buta-1,3-dienyl]-3-fluorobutan-2-imine;ethane;N'-[6-(imidazol-1-ylmethyl)-5-propyl-4H-pyrimidin-3-yl]-2-methylpropanimidamide |
| SMILES | C=C/C=C\N=C(/C)C(C)F.CC.CC.CCCC1=C(Cn2ccnc2)N=CN(/N=C(\N)C(C)C)C1 |
| InChI | InChI=1S/C15H24N6.C8H12FN.2C2H6/c1-4-5-13-8-21(19-15(16)12(2)3)11-18-14(13)9-20-7-6-17-10-20;1-4-5-6-10-8(3)7(2)9;2*1-2/h6-7,10-12H,4-5,8-9H2,1-3H3,(H2,16,19);4-7H,1H2,2-3H3;2*1-2H3/b;6-5-,10-8+;; |
| InChIKey | YHZWXRIVZVWSIV-NNAIRZTCSA-N |
| XLogP | 6.77 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.73 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|