C22H33N4+ — CID 123277217
(3E,7E)-7-ethyl-5-N-[4-(3-methylimidazol-3-ium-1-yl)but-2-en-2-yl]dodeca-3,7,10-triene-5,6-diimine (PubChem CID 123277217) has the molecular formula C22H33N4+ and a molecular weight of 353.53 g/mol. Its IUPAC name is (3E,7E)-7-ethyl-5-N-[4-(3-methylimidazol-3-ium-1-yl)but-2-en-2-yl]dodeca-3,7,10-triene-5,6-diimine.
| Compound Name | (3E,7E)-7-ethyl-5-N-[4-(3-methylimidazol-3-ium-1-yl)but-2-en-2-yl]dodeca-3,7,10-triene-5,6-diimine |
|---|---|
| PubChem CID | 123277217 |
| Molecular Formula | C22H33N4+ |
| Molecular Weight | 353.53 g/mol |
| Exact Mass | 353.27 |
| IUPAC Name | (3E,7E)-7-ethyl-5-N-[4-(3-methylimidazol-3-ium-1-yl)but-2-en-2-yl]dodeca-3,7,10-triene-5,6-diimine |
| SMILES | [H]N=C(/C(=C/CC=CC)CC)C(/C=C/CC)=N/C(C)=CCn1cc[n+](C)c1 |
| InChI | InChI=1S/C22H33N4/c1-6-9-11-12-20(8-3)22(23)21(13-10-7-2)24-19(4)14-15-26-17-16-25(5)18-26/h6,9-10,12-14,16-18,23H,7-8,11,15H2,1-5H3/q+1/b9-6?,13-10+,19-14?,20-12+,23-22+,24-21+ |
| InChIKey | NMDCVGWEGXESAO-NLOYDSGKSA-N |
| XLogP | 4.95 |
| TPSA | 45.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.53 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|