C18H12N5+ — CID 20816074
7,20,21,23-tetraza-10-azoniapentacyclo[15.2.1.12,5.17,10.112,15]tricosa-1(20),2(23),3,5,8,10(22),11,13,15(21),16,18-undecaene (PubChem CID 20816074) has the molecular formula C18H12N5+ and a molecular weight of 298.33 g/mol. Its IUPAC name is 7,20,21,23-tetraza-10-azoniapentacyclo[15.2.1.12,5.17,10.112,15]tricosa-1(20),2(23),3,5,8,10(22),11,13,15(21),16,18-undecaene.
| Compound Name | 7,20,21,23-tetraza-10-azoniapentacyclo[15.2.1.12,5.17,10.112,15]tricosa-1(20),2(23),3,5,8,10(22),11,13,15(21),16,18-undecaene |
|---|---|
| PubChem CID | 20816074 |
| Molecular Formula | C18H12N5+ |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 7,20,21,23-tetraza-10-azoniapentacyclo[15.2.1.12,5.17,10.112,15]tricosa-1(20),2(23),3,5,8,10(22),11,13,15(21),16,18-undecaene |
| SMILES | C1=C/C2=C/[n+]3ccn(c3)/C=C3/C=CC(=N3)C3=N/C(=C\C1=N2)C=C3 |
| InChI | InChI=1S/C18H12N5/c1-2-15-10-22-7-8-23(12-22)11-16-4-6-18(21-16)17-5-3-14(20-17)9-13(1)19-15/h1-12H/q+1/b14-9-,15-10-,16-11- |
| InChIKey | FSHRSJAEJHZXIZ-FTMPCSESSA-N |
| XLogP | 2.30 |
| TPSA | 45.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|