C29H31N7+2 — CID 20816100
14,20-diethyl-15,19-dimethyl-11,23,27,28,30-pentaza-1,8-diazoniahexacyclo[21.2.1.13,6.18,11.113,16.118,21]triaconta-1(26),2,4,6,8(29),9,12,14,16,18(27),19,21,24-tridecaene (PubChem CID 20816100) has the molecular formula C29H31N7+2 and a molecular weight of 477.62 g/mol. Its IUPAC name is 14,20-diethyl-15,19-dimethyl-11,23,27,28,30-pentaza-1,8-diazoniahexacyclo[21.2.1.13,6.18,11.113,16.118,21]triaconta-1(26),2,4,6,8(29),9,12,14,16,18(27),19,21,24-tridecaene.
| Compound Name | 14,20-diethyl-15,19-dimethyl-11,23,27,28,30-pentaza-1,8-diazoniahexacyclo[21.2.1.13,6.18,11.113,16.118,21]triaconta-1(26),2,4,6,8(29),9,12,14,16,18(27),19,21,24-tridecaene |
|---|---|
| PubChem CID | 20816100 |
| Molecular Formula | C29H31N7+2 |
| Molecular Weight | 477.62 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | 14,20-diethyl-15,19-dimethyl-11,23,27,28,30-pentaza-1,8-diazoniahexacyclo[21.2.1.13,6.18,11.113,16.118,21]triaconta-1(26),2,4,6,8(29),9,12,14,16,18(27),19,21,24-tridecaene |
| SMILES | CCC1=C(C)C2=N/C1=C\n1cc[n+](c1)/C=c1/cc/c([nH]1)=C/[n+]1ccn(c1)/C=c1\[nH]/c(c(C)c1CC)=C\2 |
| InChI | InChI=1S/C29H31N7/c1-5-24-20(3)26-13-27-21(4)25(6-2)29(32-27)17-36-12-10-34(19-36)15-23-8-7-22(30-23)14-33-9-11-35(18-33)16-28(24)31-26/h7-19,30-31H,5-6H2,1-4H3/q+2/b22-14-,23-15-,26-13-,28-16-,29-17- |
| InChIKey | QSMOXEHBHRENTA-FPURJKNTSA-N |
| XLogP | 1.02 |
| TPSA | 61.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.62 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|