About 5,15-diheptyl-10-(1-methylimidazol-2-yl)porphyrin;zinc
5,15-diheptyl-10-(1-methylimidazol-2-yl)porphyrin;zinc (PubChem CID 70008349) has the molecular formula C38H44N6Zn
and a molecular weight of 650.20 g/mol. Its IUPAC name is 5,15-diheptyl-10-(1-methylimidazol-2-yl)porphyrin;zinc.
Molecular Properties
| Compound Name | 5,15-diheptyl-10-(1-methylimidazol-2-yl)porphyrin;zinc |
| PubChem CID | 70008349 |
| Molecular Formula | C38H44N6Zn |
| Molecular Weight | 650.20 g/mol |
| Exact Mass | 648.29 |
| IUPAC Name | 5,15-diheptyl-10-(1-methylimidazol-2-yl)porphyrin;zinc |
| SMILES | CCCCCCC/C1=C2\C=CC(=N2)/C(c2nccn2C)=C2C=CC(=N/2)\C(CCCCCCC)=C2\C=CC(=N2)/C=C2/C=CC1=N2.[Zn] |
| InChI | InChI=1S/C38H44N6.Zn/c1-4-6-8-10-12-14-29-31-18-16-27(40-31)26-28-17-19-32(41-28)30(15-13-11-9-7-5-2)34-21-23-36(43-34)37(35-22-20-33(29)42-35)38-39-24-25-44(38)3;/h16-26H,4-15H2,1-3H3;/b27-26-,28-26-,31-29-,32-30-,33-29-,34-30-,37-35+,37-36+; |
| InChIKey | ZSGSBXGGHJWTMX-NNTOVQIKSA-N |
| XLogP | 9.30 |
| TPSA | 67.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 650.20 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5,15-diheptyl-10-(1-methylimidazol-2-yl)porphyrin;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,15-diheptyl-10-(1-methylimidazol-2-yl)porphyrin;zinc?
The IUPAC name of 5,15-diheptyl-10-(1-methylimidazol-2-yl)porphyrin;zinc (CID 70008349) is 5,15-diheptyl-10-(1-methylimidazol-2-yl)porphyrin;zinc.
What is the SMILES notation for 5,15-diheptyl-10-(1-methylimidazol-2-yl)porphyrin;zinc?
The canonical SMILES for 5,15-diheptyl-10-(1-methylimidazol-2-yl)porphyrin;zinc is CCCCCCC/C1=C2\C=CC(=N2)/C(c2nccn2C)=C2C=CC(=N/2)\C(CCCCCCC)=C2\C=CC(=N2)/C=C2/C=CC1=N2.[Zn].
What is the InChIKey of 5,15-diheptyl-10-(1-methylimidazol-2-yl)porphyrin;zinc?
The InChIKey is ZSGSBXGGHJWTMX-NNTOVQIKSA-N. The full InChI is InChI=1S/C38H44N6.Zn/c1-4-6-8-10-12-14-29-31-18-16-27(40-31)26-28-17-19-32(41-28)30(15-13-11-9-7-5-2)34-21-23-36(43-34)37(35-22-20-33(29)42-35)38-39-24-25-44(38)3;/h16-26H,4-15H2,1-3H3;/b27-26-,28-26-,31-29-,32-30-,33-29-,34-30-,37-35+,37-36+;.
What are the key properties of 5,15-diheptyl-10-(1-methylimidazol-2-yl)porphyrin;zinc?
5,15-diheptyl-10-(1-methylimidazol-2-yl)porphyrin;zinc has a molecular weight of 650.20 g/mol, XLogP of 9.30, 13 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5,15-diheptyl-10-(1-methylimidazol-2-yl)porphyrin;zinc is sourced from PubChem (CID 70008349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).