C38H44N6Zn — CID 70008349
5,15-diheptyl-10-(1-methylimidazol-2-yl)porphyrin;zinc (PubChem CID 70008349) has the molecular formula C38H44N6Zn and a molecular weight of 650.20 g/mol. Its IUPAC name is 5,15-diheptyl-10-(1-methylimidazol-2-yl)porphyrin;zinc.
| Compound Name | 5,15-diheptyl-10-(1-methylimidazol-2-yl)porphyrin;zinc |
|---|---|
| PubChem CID | 70008349 |
| Molecular Formula | C38H44N6Zn |
| Molecular Weight | 650.20 g/mol |
| Exact Mass | 648.29 |
| IUPAC Name | 5,15-diheptyl-10-(1-methylimidazol-2-yl)porphyrin;zinc |
| SMILES | CCCCCCC/C1=C2\C=CC(=N2)/C(c2nccn2C)=C2C=CC(=N/2)\C(CCCCCCC)=C2\C=CC(=N2)/C=C2/C=CC1=N2.[Zn] |
| InChI | InChI=1S/C38H44N6.Zn/c1-4-6-8-10-12-14-29-31-18-16-27(40-31)26-28-17-19-32(41-28)30(15-13-11-9-7-5-2)34-21-23-36(43-34)37(35-22-20-33(29)42-35)38-39-24-25-44(38)3;/h16-26H,4-15H2,1-3H3;/b27-26-,28-26-,31-29-,32-30-,33-29-,34-30-,37-35+,37-36+; |
| InChIKey | ZSGSBXGGHJWTMX-NNTOVQIKSA-N |
| XLogP | 9.30 |
| TPSA | 67.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.20 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|