C44H54N6SiZn — CID 87940370
1-[10,20-diheptyl-15-(1-methylimidazol-2-yl)porphyrin-5-yl]prop-2-ynyl-trimethylsilane;zinc (PubChem CID 87940370) has the molecular formula C44H54N6SiZn and a molecular weight of 760.43 g/mol. Its IUPAC name is 1-[10,20-diheptyl-15-(1-methylimidazol-2-yl)porphyrin-5-yl]prop-2-ynyl-trimethylsilane;zinc.
| Compound Name | 1-[10,20-diheptyl-15-(1-methylimidazol-2-yl)porphyrin-5-yl]prop-2-ynyl-trimethylsilane;zinc |
|---|---|
| PubChem CID | 87940370 |
| Molecular Formula | C44H54N6SiZn |
| Molecular Weight | 760.43 g/mol |
| Exact Mass | 758.35 |
| IUPAC Name | 1-[10,20-diheptyl-15-(1-methylimidazol-2-yl)porphyrin-5-yl]prop-2-ynyl-trimethylsilane;zinc |
| SMILES | C#CC(/C1=C2\C=CC(=N2)/C(CCCCCCC)=C2/C=CC(=N2)/C(c2nccn2C)=C2/C=CC(=N2)/C(CCCCCCC)=C2/C=CC1=N2)[Si](C)(C)C.[Zn] |
| InChI | InChI=1S/C44H54N6Si.Zn/c1-8-11-13-15-17-19-31-33-21-25-37(46-33)42(41(10-3)51(5,6)7)38-26-22-34(47-38)32(20-18-16-14-12-9-2)36-24-28-40(49-36)43(39-27-23-35(31)48-39)44-45-29-30-50(44)4;/h3,21-30,41H,8-9,11-20H2,1-2,4-7H3;/b33-31-,34-32-,35-31-,36-32-,42-37+,42-38+,43-39+,43-40+; |
| InChIKey | COBLFTNWVPXYHQ-VJDKNBEESA-N |
| XLogP | 11.01 |
| TPSA | 67.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.43 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|