C40H44N6Zn — CID 87940192
5-ethynyl-10,20-diheptyl-15-(1-methylimidazol-2-yl)porphyrin;zinc (PubChem CID 87940192) has the molecular formula C40H44N6Zn and a molecular weight of 674.22 g/mol. Its IUPAC name is 5-ethynyl-10,20-diheptyl-15-(1-methylimidazol-2-yl)porphyrin;zinc.
| Compound Name | 5-ethynyl-10,20-diheptyl-15-(1-methylimidazol-2-yl)porphyrin;zinc |
|---|---|
| PubChem CID | 87940192 |
| Molecular Formula | C40H44N6Zn |
| Molecular Weight | 674.22 g/mol |
| Exact Mass | 672.29 |
| IUPAC Name | 5-ethynyl-10,20-diheptyl-15-(1-methylimidazol-2-yl)porphyrin;zinc |
| SMILES | C#C/C1=C2\C=CC(=N2)/C(CCCCCCC)=C2/C=CC(=N2)/C(c2nccn2C)=C2C=CC(=N/2)\C(CCCCCCC)=C2\C=CC1=N2.[Zn] |
| InChI | InChI=1S/C40H44N6.Zn/c1-5-8-10-12-14-16-29-33-20-18-31(42-33)28(7-3)32-19-21-34(43-32)30(17-15-13-11-9-6-2)36-23-25-38(45-36)39(37-24-22-35(29)44-37)40-41-26-27-46(40)4;/h3,18-27H,5-6,8-17H2,1-2,4H3;/b31-28-,32-28-,33-29-,34-30-,35-29-,36-30-,39-37+,39-38+; |
| InChIKey | SJEOEGYXASULOC-NYGGYUHHSA-N |
| XLogP | 9.30 |
| TPSA | 67.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.22 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|