C27H39N2+ — CID 159171271
3-[2,6-di(propan-2-yl)cyclohexa-1,4-dien-1-yl]-1-[2,6-di(propan-2-yl)cyclohexa-2,5-dien-1-yl]-4H-imidazole-1,3-diium-4-ide (PubChem CID 159171271) has the molecular formula C27H39N2+ and a molecular weight of 391.62 g/mol. Its IUPAC name is 3-[2,6-di(propan-2-yl)cyclohexa-1,4-dien-1-yl]-1-[2,6-di(propan-2-yl)cyclohexa-2,5-dien-1-yl]-4H-imidazole-1,3-diium-4-ide.
| Compound Name | 3-[2,6-di(propan-2-yl)cyclohexa-1,4-dien-1-yl]-1-[2,6-di(propan-2-yl)cyclohexa-2,5-dien-1-yl]-4H-imidazole-1,3-diium-4-ide |
|---|---|
| PubChem CID | 159171271 |
| Molecular Formula | C27H39N2+ |
| Molecular Weight | 391.62 g/mol |
| Exact Mass | 391.31 |
| IUPAC Name | 3-[2,6-di(propan-2-yl)cyclohexa-1,4-dien-1-yl]-1-[2,6-di(propan-2-yl)cyclohexa-2,5-dien-1-yl]-4H-imidazole-1,3-diium-4-ide |
| SMILES | CC(C)C1=CCC=C(C(C)C)[C-]1[n+]1c[cH-][n+](C2=C(C(C)C)[CH+]C=CC2C(C)C)c1 |
| InChI | InChI=1S/C27H39N2/c1-18(2)22-11-9-12-23(19(3)4)26(22)28-15-16-29(17-28)27-24(20(5)6)13-10-14-25(27)21(7)8/h9,11-22H,10H2,1-8H3/q+1 |
| InChIKey | RLPILRBYGHTZNP-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.62 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|