C20H29N7 — CID 142996661
3-ethanimidoyl-6-(imidazol-1-ylmethyl)-5-propylpyrimidin-4-imine;1-(2-ethenylcyclopropyl)ethanimine (PubChem CID 142996661) has the molecular formula C20H29N7 and a molecular weight of 367.50 g/mol. Its IUPAC name is 3-ethanimidoyl-6-(imidazol-1-ylmethyl)-5-propylpyrimidin-4-imine;1-(2-ethenylcyclopropyl)ethanimine.
| Compound Name | 3-ethanimidoyl-6-(imidazol-1-ylmethyl)-5-propylpyrimidin-4-imine;1-(2-ethenylcyclopropyl)ethanimine |
|---|---|
| PubChem CID | 142996661 |
| Molecular Formula | C20H29N7 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | 3-ethanimidoyl-6-(imidazol-1-ylmethyl)-5-propylpyrimidin-4-imine;1-(2-ethenylcyclopropyl)ethanimine |
| SMILES | [H]/N=C(\C)C1CC1C=C.[H]/N=c1/c(CCC)c(Cn2ccnc2)ncn1/C(C)=N/[H] |
| InChI | InChI=1S/C13H18N6.C7H11N/c1-3-4-11-12(7-18-6-5-16-8-18)17-9-19(10(2)14)13(11)15;1-3-6-4-7(6)5(2)8/h5-6,8-9,14-15H,3-4,7H2,1-2H3;3,6-8H,1,4H2,2H3/b14-10+,15-13-;8-5+ |
| InChIKey | HLJKCKLMIKVHGA-YTYDDXQLSA-N |
| XLogP | 3.25 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|