C21H30FN7O — CID 142996689
1-(2-ethenyl-1-fluorocyclopropyl)ethanimine;6-(imidazol-1-ylmethyl)-3-(2-methoxyethanimidoyl)-5-propylpyrimidin-4-imine (PubChem CID 142996689) has the molecular formula C21H30FN7O and a molecular weight of 415.52 g/mol. Its IUPAC name is 1-(2-ethenyl-1-fluorocyclopropyl)ethanimine;6-(imidazol-1-ylmethyl)-3-(2-methoxyethanimidoyl)-5-propylpyrimidin-4-imine.
| Compound Name | 1-(2-ethenyl-1-fluorocyclopropyl)ethanimine;6-(imidazol-1-ylmethyl)-3-(2-methoxyethanimidoyl)-5-propylpyrimidin-4-imine |
|---|---|
| PubChem CID | 142996689 |
| Molecular Formula | C21H30FN7O |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | 1-(2-ethenyl-1-fluorocyclopropyl)ethanimine;6-(imidazol-1-ylmethyl)-3-(2-methoxyethanimidoyl)-5-propylpyrimidin-4-imine |
| SMILES | [H]/N=C(\C)C1(F)CC1C=C.[H]/N=C(\COC)n1cnc(Cn2ccnc2)c(CCC)/c1=N\[H] |
| InChI | InChI=1S/C14H20N6O.C7H10FN/c1-3-4-11-12(7-19-6-5-17-9-19)18-10-20(14(11)16)13(15)8-21-2;1-3-6-4-7(6,8)5(2)9/h5-6,9-10,15-16H,3-4,7-8H2,1-2H3;3,6,9H,1,4H2,2H3/b15-13+,16-14+;9-5+ |
| InChIKey | JRNCQESLJNXGJP-DUEJPZCOSA-N |
| XLogP | 2.97 |
| TPSA | 116.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|