C23H29FN4O4 — CID 142997006
ethanamine;N-[[3-[3-fluoro-4-[4-(1-formamidoethyl)phenyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 142997006) has the molecular formula C23H29FN4O4 and a molecular weight of 444.51 g/mol. Its IUPAC name is ethanamine;N-[[3-[3-fluoro-4-[4-(1-formamidoethyl)phenyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | ethanamine;N-[[3-[3-fluoro-4-[4-(1-formamidoethyl)phenyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 142997006 |
| Molecular Formula | C23H29FN4O4 |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | ethanamine;N-[[3-[3-fluoro-4-[4-(1-formamidoethyl)phenyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CN(c2ccc(-c3ccc(C(C)NC=O)cc3)c(F)c2)C(=O)O1.CCN |
| InChI | InChI=1S/C21H22FN3O4.C2H7N/c1-13(24-12-26)15-3-5-16(6-4-15)19-8-7-17(9-20(19)22)25-11-18(29-21(25)28)10-23-14(2)27;1-2-3/h3-9,12-13,18H,10-11H2,1-2H3,(H,23,27)(H,24,26);2-3H2,1H3 |
| InChIKey | FZFCXAPABAMFKO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|