C24H28FN3O3 — CID 142997068
acetaldehyde;3-[4-[4-[(but-3-yn-2-ylamino)methyl]phenyl]-3-fluorophenyl]-5-(methylaminomethyl)-1,3-oxazolidin-2-one (PubChem CID 142997068) has the molecular formula C24H28FN3O3 and a molecular weight of 425.50 g/mol. Its IUPAC name is acetaldehyde;3-[4-[4-[(but-3-yn-2-ylamino)methyl]phenyl]-3-fluorophenyl]-5-(methylaminomethyl)-1,3-oxazolidin-2-one.
| Compound Name | acetaldehyde;3-[4-[4-[(but-3-yn-2-ylamino)methyl]phenyl]-3-fluorophenyl]-5-(methylaminomethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 142997068 |
| Molecular Formula | C24H28FN3O3 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | acetaldehyde;3-[4-[4-[(but-3-yn-2-ylamino)methyl]phenyl]-3-fluorophenyl]-5-(methylaminomethyl)-1,3-oxazolidin-2-one |
| SMILES | C#CC(C)NCc1ccc(-c2ccc(N3CC(CNC)OC3=O)cc2F)cc1.CC=O |
| InChI | InChI=1S/C22H24FN3O2.C2H4O/c1-4-15(2)25-12-16-5-7-17(8-6-16)20-10-9-18(11-21(20)23)26-14-19(13-24-3)28-22(26)27;1-2-3/h1,5-11,15,19,24-25H,12-14H2,2-3H3;2H,1H3 |
| InChIKey | VFPPQFPFKXFAGW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|