About 1,2-dihydrobenzo[cd]indole
1,2-dihydrobenzo[cd]indole (PubChem CID 14299730) has the molecular formula C11H9N
and a molecular weight of 155.20 g/mol. Its IUPAC name is 1,2-dihydrobenzo[cd]indole.
Molecular Properties
| Compound Name | 1,2-dihydrobenzo[cd]indole |
| PubChem CID | 14299730 |
| Molecular Formula | C11H9N |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | 1,2-dihydrobenzo[cd]indole |
| SMILES | c1cc2c3c(cccc3c1)NC2 |
| InChI | InChI=1S/C11H9N/c1-3-8-4-2-6-10-11(8)9(5-1)7-12-10/h1-6,12H,7H2 |
| InChIKey | HFJHUOIVZVHBBM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,2-dihydrobenzo[cd]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dihydrobenzo[cd]indole?
The IUPAC name of 1,2-dihydrobenzo[cd]indole (CID 14299730) is 1,2-dihydrobenzo[cd]indole.
What is the SMILES notation for 1,2-dihydrobenzo[cd]indole?
The canonical SMILES for 1,2-dihydrobenzo[cd]indole is c1cc2c3c(cccc3c1)NC2.
What is the InChIKey of 1,2-dihydrobenzo[cd]indole?
The InChIKey is HFJHUOIVZVHBBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N/c1-3-8-4-2-6-10-11(8)9(5-1)7-12-10/h1-6,12H,7H2.
What are the key properties of 1,2-dihydrobenzo[cd]indole?
1,2-dihydrobenzo[cd]indole has a molecular weight of 155.20 g/mol, XLogP of 2.77, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydrobenzo[cd]indole is sourced from PubChem (CID 14299730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).