C29H26FN5O — CID 142998832
N-[(S)-cyclopropyl(phenyl)methyl]-2-(3-fluorophenyl)-3-[[(2Z)-2-(2-iminoethylidene)hydrazinyl]methyl]quinoline-4-carboxamide (PubChem CID 142998832) has the molecular formula C29H26FN5O and a molecular weight of 479.56 g/mol. Its IUPAC name is N-[(S)-cyclopropyl(phenyl)methyl]-2-(3-fluorophenyl)-3-[[(2Z)-2-(2-iminoethylidene)hydrazinyl]methyl]quinoline-4-carboxamide.
| Compound Name | N-[(S)-cyclopropyl(phenyl)methyl]-2-(3-fluorophenyl)-3-[[(2Z)-2-(2-iminoethylidene)hydrazinyl]methyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 142998832 |
| Molecular Formula | C29H26FN5O |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | N-[(S)-cyclopropyl(phenyl)methyl]-2-(3-fluorophenyl)-3-[[(2Z)-2-(2-iminoethylidene)hydrazinyl]methyl]quinoline-4-carboxamide |
| SMILES | [H]/N=C\C=N/NCc1c(-c2cccc(F)c2)nc2ccccc2c1C(=O)N[C@H](c1ccccc1)C1CC1 |
| InChI | InChI=1S/C29H26FN5O/c30-22-10-6-9-21(17-22)28-24(18-33-32-16-15-31)26(23-11-4-5-12-25(23)34-28)29(36)35-27(20-13-14-20)19-7-2-1-3-8-19/h1-12,15-17,20,27,31,33H,13-14,18H2,(H,35,36)/b31-15-,32-16-/t27-/m1/s1 |
| InChIKey | RLUHJKNSHRIACE-YFHGMVLYSA-N |
| XLogP | 5.65 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|