C29H29N2OPS — CID 143429029
N-[cyclopropyl-(3-phosphanylphenyl)methyl]-3-(2-methylsulfanylethyl)-2-phenylquinoline-4-carboxamide (PubChem CID 143429029) has the molecular formula C29H29N2OPS and a molecular weight of 484.61 g/mol. Its IUPAC name is N-[cyclopropyl-(3-phosphanylphenyl)methyl]-3-(2-methylsulfanylethyl)-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[cyclopropyl-(3-phosphanylphenyl)methyl]-3-(2-methylsulfanylethyl)-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 143429029 |
| Molecular Formula | C29H29N2OPS |
| Molecular Weight | 484.61 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | N-[cyclopropyl-(3-phosphanylphenyl)methyl]-3-(2-methylsulfanylethyl)-2-phenylquinoline-4-carboxamide |
| SMILES | CSCCc1c(-c2ccccc2)nc2ccccc2c1C(=O)NC(c1cccc(P)c1)C1CC1 |
| InChI | InChI=1S/C29H29N2OPS/c1-34-17-16-24-26(29(32)31-27(20-14-15-20)21-10-7-11-22(33)18-21)23-12-5-6-13-25(23)30-28(24)19-8-3-2-4-9-19/h2-13,18,20,27H,14-17,33H2,1H3,(H,31,32) |
| InChIKey | GEELMXKGAWYSPS-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.61 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|