C31H42N4O — CID 143000317
N-[8-amino-2-[[(1Z)-7-methylcyclononen-1-yl]methyl]-5,6-dihydrobenzo[f]quinoxalin-3-yl]-2-cyclohexylacetamide (PubChem CID 143000317) has the molecular formula C31H42N4O and a molecular weight of 486.70 g/mol. Its IUPAC name is N-[8-amino-2-[[(1Z)-7-methylcyclononen-1-yl]methyl]-5,6-dihydrobenzo[f]quinoxalin-3-yl]-2-cyclohexylacetamide.
| Compound Name | N-[8-amino-2-[[(1Z)-7-methylcyclononen-1-yl]methyl]-5,6-dihydrobenzo[f]quinoxalin-3-yl]-2-cyclohexylacetamide |
|---|---|
| PubChem CID | 143000317 |
| Molecular Formula | C31H42N4O |
| Molecular Weight | 486.70 g/mol |
| Exact Mass | 486.34 |
| IUPAC Name | N-[8-amino-2-[[(1Z)-7-methylcyclononen-1-yl]methyl]-5,6-dihydrobenzo[f]quinoxalin-3-yl]-2-cyclohexylacetamide |
| SMILES | CC1CCCC/C=C(\Cc2nc3c(nc2NC(=O)CC2CCCCC2)CCc2cc(N)ccc2-3)CC1 |
| InChI | InChI=1S/C31H42N4O/c1-21-8-4-2-5-11-23(13-12-21)18-28-31(35-29(36)19-22-9-6-3-7-10-22)34-27-17-14-24-20-25(32)15-16-26(24)30(27)33-28/h11,15-16,20-22H,2-10,12-14,17-19,32H2,1H3,(H,34,35,36)/b23-11- |
| InChIKey | OZJGENPCRGUDQB-KSEXSDGBSA-N |
| XLogP | 7.19 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.70 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|