C30H33ClN6O3 — CID 143001727
cyclopropylmethyl N-[[(10E)-14-chloro-2-(4-formylpiperazin-1-yl)-4-azatricyclo[10.4.0.03,8]hexadeca-1(12),3(8),4,6,10,13,15-heptaen-11-yl]-(3-methylimidazol-4-yl)methyl]carbamate (PubChem CID 143001727) has the molecular formula C30H33ClN6O3 and a molecular weight of 561.09 g/mol. Its IUPAC name is cyclopropylmethyl N-[[(10E)-14-chloro-2-(4-formylpiperazin-1-yl)-4-azatricyclo[10.4.0.03,8]hexadeca-1(12),3(8),4,6,10,13,15-heptaen-11-yl]-(3-methylimidazol-4-yl)methyl]carbamate.
| Compound Name | cyclopropylmethyl N-[[(10E)-14-chloro-2-(4-formylpiperazin-1-yl)-4-azatricyclo[10.4.0.03,8]hexadeca-1(12),3(8),4,6,10,13,15-heptaen-11-yl]-(3-methylimidazol-4-yl)methyl]carbamate |
|---|---|
| PubChem CID | 143001727 |
| Molecular Formula | C30H33ClN6O3 |
| Molecular Weight | 561.09 g/mol |
| Exact Mass | 560.23 |
| IUPAC Name | cyclopropylmethyl N-[[(10E)-14-chloro-2-(4-formylpiperazin-1-yl)-4-azatricyclo[10.4.0.03,8]hexadeca-1(12),3(8),4,6,10,13,15-heptaen-11-yl]-(3-methylimidazol-4-yl)methyl]carbamate |
| SMILES | Cn1cncc1C(NC(=O)OCC1CC1)/C1=C/Cc2cccnc2C(N2CCN(C=O)CC2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C30H33ClN6O3/c1-35-18-32-16-26(35)28(34-30(39)40-17-20-4-5-20)23-8-6-21-3-2-10-33-27(21)29(24-9-7-22(31)15-25(23)24)37-13-11-36(19-38)12-14-37/h2-3,7-10,15-16,18-20,28-29H,4-6,11-14,17H2,1H3,(H,34,39)/b23-8+ |
| InChIKey | QMUJNHWMTPQGGB-LIMNOBDPSA-N |
| XLogP | 4.15 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.09 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|