C10H15N3O2 — CID 143001799
(1-methylcyclopropyl) N-[(3-methylimidazol-4-yl)methyl]carbamate (PubChem CID 143001799) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is (1-methylcyclopropyl) N-[(3-methylimidazol-4-yl)methyl]carbamate.
| Compound Name | (1-methylcyclopropyl) N-[(3-methylimidazol-4-yl)methyl]carbamate |
|---|---|
| PubChem CID | 143001799 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | (1-methylcyclopropyl) N-[(3-methylimidazol-4-yl)methyl]carbamate |
| SMILES | Cn1cncc1CNC(=O)OC1(C)CC1 |
| InChI | InChI=1S/C10H15N3O2/c1-10(3-4-10)15-9(14)12-6-8-5-11-7-13(8)2/h5,7H,3-4,6H2,1-2H3,(H,12,14) |
| InChIKey | CFHWXAWZLWKYSV-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |