About (1-methylcyclopropyl) N-[(3-methylimidazol-4-yl)methyl]carbamate
(1-methylcyclopropyl) N-[(3-methylimidazol-4-yl)methyl]carbamate (PubChem CID 143001799) has the molecular formula C10H15N3O2
and a molecular weight of 209.25 g/mol. Its IUPAC name is (1-methylcyclopropyl) N-[(3-methylimidazol-4-yl)methyl]carbamate.
Molecular Properties
| Compound Name | (1-methylcyclopropyl) N-[(3-methylimidazol-4-yl)methyl]carbamate |
| PubChem CID | 143001799 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | (1-methylcyclopropyl) N-[(3-methylimidazol-4-yl)methyl]carbamate |
| SMILES | Cn1cncc1CNC(=O)OC1(C)CC1 |
| InChI | InChI=1S/C10H15N3O2/c1-10(3-4-10)15-9(14)12-6-8-5-11-7-13(8)2/h5,7H,3-4,6H2,1-2H3,(H,12,14) |
| InChIKey | CFHWXAWZLWKYSV-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-methylcyclopropyl) N-[(3-methylimidazol-4-yl)methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylcyclopropyl) N-[(3-methylimidazol-4-yl)methyl]carbamate?
The IUPAC name of (1-methylcyclopropyl) N-[(3-methylimidazol-4-yl)methyl]carbamate (CID 143001799) is (1-methylcyclopropyl) N-[(3-methylimidazol-4-yl)methyl]carbamate.
What is the SMILES notation for (1-methylcyclopropyl) N-[(3-methylimidazol-4-yl)methyl]carbamate?
The canonical SMILES for (1-methylcyclopropyl) N-[(3-methylimidazol-4-yl)methyl]carbamate is Cn1cncc1CNC(=O)OC1(C)CC1.
What is the InChIKey of (1-methylcyclopropyl) N-[(3-methylimidazol-4-yl)methyl]carbamate?
The InChIKey is CFHWXAWZLWKYSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O2/c1-10(3-4-10)15-9(14)12-6-8-5-11-7-13(8)2/h5,7H,3-4,6H2,1-2H3,(H,12,14).
What are the key properties of (1-methylcyclopropyl) N-[(3-methylimidazol-4-yl)methyl]carbamate?
(1-methylcyclopropyl) N-[(3-methylimidazol-4-yl)methyl]carbamate has a molecular weight of 209.25 g/mol, XLogP of 1.20, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylcyclopropyl) N-[(3-methylimidazol-4-yl)methyl]carbamate is sourced from PubChem (CID 143001799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).