C36H36N2O4 — CID 143002115
7-(4-tert-butylphenoxy)-N-[2-(4-phenylphenyl)ethyl]isoquinoline-3-carboxamide;methyl formate (PubChem CID 143002115) has the molecular formula C36H36N2O4 and a molecular weight of 560.69 g/mol. Its IUPAC name is 7-(4-tert-butylphenoxy)-N-[2-(4-phenylphenyl)ethyl]isoquinoline-3-carboxamide;methyl formate.
| Compound Name | 7-(4-tert-butylphenoxy)-N-[2-(4-phenylphenyl)ethyl]isoquinoline-3-carboxamide;methyl formate |
|---|---|
| PubChem CID | 143002115 |
| Molecular Formula | C36H36N2O4 |
| Molecular Weight | 560.69 g/mol |
| Exact Mass | 560.27 |
| IUPAC Name | 7-(4-tert-butylphenoxy)-N-[2-(4-phenylphenyl)ethyl]isoquinoline-3-carboxamide;methyl formate |
| SMILES | CC(C)(C)c1ccc(Oc2ccc3cc(C(=O)NCCc4ccc(-c5ccccc5)cc4)ncc3c2)cc1.COC=O |
| InChI | InChI=1S/C34H32N2O2.C2H4O2/c1-34(2,3)29-14-17-30(18-15-29)38-31-16-13-27-22-32(36-23-28(27)21-31)33(37)35-20-19-24-9-11-26(12-10-24)25-7-5-4-6-8-25;1-4-2-3/h4-18,21-23H,19-20H2,1-3H3,(H,35,37);2H,1H3 |
| InChIKey | LPNURNNTHANILV-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.69 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|