C36H40N4O4 — CID 143002287
N-[(2S)-1-(1-aminoethylideneamino)-3-(4-cyclopentyloxyphenyl)-1-oxopropan-2-yl]-6-(4-tert-butylphenoxy)isoquinoline-3-carboxamide (PubChem CID 143002287) has the molecular formula C36H40N4O4 and a molecular weight of 592.74 g/mol. Its IUPAC name is N-[(2S)-1-(1-aminoethylideneamino)-3-(4-cyclopentyloxyphenyl)-1-oxopropan-2-yl]-6-(4-tert-butylphenoxy)isoquinoline-3-carboxamide.
| Compound Name | N-[(2S)-1-(1-aminoethylideneamino)-3-(4-cyclopentyloxyphenyl)-1-oxopropan-2-yl]-6-(4-tert-butylphenoxy)isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 143002287 |
| Molecular Formula | C36H40N4O4 |
| Molecular Weight | 592.74 g/mol |
| Exact Mass | 592.30 |
| IUPAC Name | N-[(2S)-1-(1-aminoethylideneamino)-3-(4-cyclopentyloxyphenyl)-1-oxopropan-2-yl]-6-(4-tert-butylphenoxy)isoquinoline-3-carboxamide |
| SMILES | C/C(N)=N\C(=O)[C@H](Cc1ccc(OC2CCCC2)cc1)NC(=O)c1cc2cc(Oc3ccc(C(C)(C)C)cc3)ccc2cn1 |
| InChI | InChI=1S/C36H40N4O4/c1-23(37)39-35(42)33(19-24-9-14-29(15-10-24)43-28-7-5-6-8-28)40-34(41)32-21-26-20-31(16-11-25(26)22-38-32)44-30-17-12-27(13-18-30)36(2,3)4/h9-18,20-22,28,33H,5-8,19H2,1-4H3,(H,40,41)(H2,37,39,42)/t33-/m0/s1 |
| InChIKey | RTJSTAJXAGRODB-XIFFEERXSA-N |
| XLogP | 6.89 |
| TPSA | 115.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.74 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|