About N-(4-fluorocyclohexa-2,4-dien-1-yl)methanethioamide
N-(4-fluorocyclohexa-2,4-dien-1-yl)methanethioamide (PubChem CID 143003089) has the molecular formula C7H8FNS
and a molecular weight of 157.21 g/mol. Its IUPAC name is N-(4-fluorocyclohexa-2,4-dien-1-yl)methanethioamide.
Molecular Properties
| Compound Name | N-(4-fluorocyclohexa-2,4-dien-1-yl)methanethioamide |
| PubChem CID | 143003089 |
| Molecular Formula | C7H8FNS |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.04 |
| IUPAC Name | N-(4-fluorocyclohexa-2,4-dien-1-yl)methanethioamide |
| SMILES | FC1=CCC(NC=S)C=C1 |
| InChI | InChI=1S/C7H8FNS/c8-6-1-3-7(4-2-6)9-5-10/h1-3,5,7H,4H2,(H,9,10) |
| InChIKey | VHBKQZWGWGZREP-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-(4-fluorocyclohexa-2,4-dien-1-yl)methanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-fluorocyclohexa-2,4-dien-1-yl)methanethioamide?
The IUPAC name of N-(4-fluorocyclohexa-2,4-dien-1-yl)methanethioamide (CID 143003089) is N-(4-fluorocyclohexa-2,4-dien-1-yl)methanethioamide.
What is the SMILES notation for N-(4-fluorocyclohexa-2,4-dien-1-yl)methanethioamide?
The canonical SMILES for N-(4-fluorocyclohexa-2,4-dien-1-yl)methanethioamide is FC1=CCC(NC=S)C=C1.
What is the InChIKey of N-(4-fluorocyclohexa-2,4-dien-1-yl)methanethioamide?
The InChIKey is VHBKQZWGWGZREP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8FNS/c8-6-1-3-7(4-2-6)9-5-10/h1-3,5,7H,4H2,(H,9,10).
What are the key properties of N-(4-fluorocyclohexa-2,4-dien-1-yl)methanethioamide?
N-(4-fluorocyclohexa-2,4-dien-1-yl)methanethioamide has a molecular weight of 157.21 g/mol, XLogP of 1.72, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-fluorocyclohexa-2,4-dien-1-yl)methanethioamide is sourced from PubChem (CID 143003089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).