C9H14FNS — CID 142153689
N-[(Z,3E)-3-ethylidene-6-fluorohex-4-en-2-yl]methanethioamide (PubChem CID 142153689) has the molecular formula C9H14FNS and a molecular weight of 187.28 g/mol. Its IUPAC name is N-[(Z,3E)-3-ethylidene-6-fluorohex-4-en-2-yl]methanethioamide.
| Compound Name | N-[(Z,3E)-3-ethylidene-6-fluorohex-4-en-2-yl]methanethioamide |
|---|---|
| PubChem CID | 142153689 |
| Molecular Formula | C9H14FNS |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | N-[(Z,3E)-3-ethylidene-6-fluorohex-4-en-2-yl]methanethioamide |
| SMILES | C/C=C(\C=C/CF)C(C)NC=S |
| InChI | InChI=1S/C9H14FNS/c1-3-9(5-4-6-10)8(2)11-7-12/h3-5,7-8H,6H2,1-2H3,(H,11,12)/b5-4-,9-3+ |
| InChIKey | MCXGOVPDQPNFDF-SMPMWSNWSA-N |
| XLogP | 2.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|