About 1-(4-fluorocyclohexa-1,5-dien-1-yl)-N-methylethanamine
1-(4-fluorocyclohexa-1,5-dien-1-yl)-N-methylethanamine (PubChem CID 178087421) has the molecular formula C9H14FN
and a molecular weight of 155.22 g/mol. Its IUPAC name is 1-(4-fluorocyclohexa-1,5-dien-1-yl)-N-methylethanamine.
Analyze 1-(4-fluorocyclohexa-1,5-dien-1-yl)-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluorocyclohexa-1,5-dien-1-yl)-N-methylethanamine?
The IUPAC name of 1-(4-fluorocyclohexa-1,5-dien-1-yl)-N-methylethanamine (CID 178087421) is 1-(4-fluorocyclohexa-1,5-dien-1-yl)-N-methylethanamine.
What is the SMILES notation for 1-(4-fluorocyclohexa-1,5-dien-1-yl)-N-methylethanamine?
The canonical SMILES for 1-(4-fluorocyclohexa-1,5-dien-1-yl)-N-methylethanamine is CNC(C)C1=CCC(F)C=C1.
What is the InChIKey of 1-(4-fluorocyclohexa-1,5-dien-1-yl)-N-methylethanamine?
The InChIKey is DGJVGWGBLDXCLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14FN/c1-7(11-2)8-3-5-9(10)6-4-8/h3-5,7,9,11H,6H2,1-2H3.
What are the key properties of 1-(4-fluorocyclohexa-1,5-dien-1-yl)-N-methylethanamine?
1-(4-fluorocyclohexa-1,5-dien-1-yl)-N-methylethanamine has a molecular weight of 155.22 g/mol, XLogP of 1.82, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluorocyclohexa-1,5-dien-1-yl)-N-methylethanamine is sourced from PubChem (CID 178087421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).