C11H19NS — CID 142153733
N-[(Z,3E)-3-propylidenehept-4-en-2-yl]methanethioamide (PubChem CID 142153733) has the molecular formula C11H19NS and a molecular weight of 197.35 g/mol. Its IUPAC name is N-[(Z,3E)-3-propylidenehept-4-en-2-yl]methanethioamide.
| Compound Name | N-[(Z,3E)-3-propylidenehept-4-en-2-yl]methanethioamide |
|---|---|
| PubChem CID | 142153733 |
| Molecular Formula | C11H19NS |
| Molecular Weight | 197.35 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | N-[(Z,3E)-3-propylidenehept-4-en-2-yl]methanethioamide |
| SMILES | CC/C=C\C(=C/CC)C(C)NC=S |
| InChI | InChI=1S/C11H19NS/c1-4-6-8-11(7-5-2)10(3)12-9-13/h6-10H,4-5H2,1-3H3,(H,12,13)/b8-6-,11-7+ |
| InChIKey | IOVPJKWTXNOBNN-FAWHLJIPSA-N |
| XLogP | 3.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|