C9H15NS — CID 90953180
N-(3-methylhepta-3,5-dien-2-yl)methanethioamide (PubChem CID 90953180) has the molecular formula C9H15NS and a molecular weight of 169.29 g/mol. Its IUPAC name is N-(3-methylhepta-3,5-dien-2-yl)methanethioamide.
| Compound Name | N-(3-methylhepta-3,5-dien-2-yl)methanethioamide |
|---|---|
| PubChem CID | 90953180 |
| Molecular Formula | C9H15NS |
| Molecular Weight | 169.29 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | N-(3-methylhepta-3,5-dien-2-yl)methanethioamide |
| SMILES | CC=CC=C(C)C(C)NC=S |
| InChI | InChI=1S/C9H15NS/c1-4-5-6-8(2)9(3)10-7-11/h4-7,9H,1-3H3,(H,10,11) |
| InChIKey | ZHPIOXZVRUXASW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|