C9H15N — CID 142050522
(3E)-3-ethenyl-N-methylhexa-3,5-dien-2-amine (PubChem CID 142050522) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is (3E)-3-ethenyl-N-methylhexa-3,5-dien-2-amine.
| Compound Name | (3E)-3-ethenyl-N-methylhexa-3,5-dien-2-amine |
|---|---|
| PubChem CID | 142050522 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | (3E)-3-ethenyl-N-methylhexa-3,5-dien-2-amine |
| SMILES | C=C/C=C(\C=C)C(C)NC |
| InChI | InChI=1S/C9H15N/c1-5-7-9(6-2)8(3)10-4/h5-8,10H,1-2H2,3-4H3/b9-7+ |
| InChIKey | JQCXQPUTZQTSNC-VQHVLOKHSA-N |
| XLogP | 1.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|