C10H11F2NS — CID 163863357
N-[(4Z,6E)-8,8-difluoro-7-methylocta-4,6-dien-1-yn-3-yl]methanethioamide (PubChem CID 163863357) has the molecular formula C10H11F2NS and a molecular weight of 215.27 g/mol. Its IUPAC name is N-[(4Z,6E)-8,8-difluoro-7-methylocta-4,6-dien-1-yn-3-yl]methanethioamide.
| Compound Name | N-[(4Z,6E)-8,8-difluoro-7-methylocta-4,6-dien-1-yn-3-yl]methanethioamide |
|---|---|
| PubChem CID | 163863357 |
| Molecular Formula | C10H11F2NS |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | N-[(4Z,6E)-8,8-difluoro-7-methylocta-4,6-dien-1-yn-3-yl]methanethioamide |
| SMILES | C#CC(/C=C\C=C(/C)C(F)F)NC=S |
| InChI | InChI=1S/C10H11F2NS/c1-3-9(13-7-14)6-4-5-8(2)10(11)12/h1,4-7,9-10H,2H3,(H,13,14)/b6-4-,8-5+ |
| InChIKey | PEMMUEDDKVHIQM-QXMOYCCXSA-N |
| XLogP | 2.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|