C21H27FN2 — CID 143005240
4-cyclohexa-1,5-dien-1-yl-1-(4-fluoropyrrolidin-3-yl)-2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2,5-dihydropyrrole (PubChem CID 143005240) has the molecular formula C21H27FN2 and a molecular weight of 326.46 g/mol. Its IUPAC name is 4-cyclohexa-1,5-dien-1-yl-1-(4-fluoropyrrolidin-3-yl)-2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2,5-dihydropyrrole.
| Compound Name | 4-cyclohexa-1,5-dien-1-yl-1-(4-fluoropyrrolidin-3-yl)-2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2,5-dihydropyrrole |
|---|---|
| PubChem CID | 143005240 |
| Molecular Formula | C21H27FN2 |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | 4-cyclohexa-1,5-dien-1-yl-1-(4-fluoropyrrolidin-3-yl)-2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2,5-dihydropyrrole |
| SMILES | C=C/C=C\C(=C/C)C1C=C(C2=CCCC=C2)CN1C1CNCC1F |
| InChI | InChI=1S/C21H27FN2/c1-3-5-9-16(4-2)20-12-18(17-10-7-6-8-11-17)15-24(20)21-14-23-13-19(21)22/h3-5,7,9-12,19-21,23H,1,6,8,13-15H2,2H3/b9-5-,16-4+ |
| InChIKey | TZIRRTOSCXAFHS-NLKMMNARSA-N |
| XLogP | 3.87 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|