C19H28F3N3 — CID 155002007
(4Z)-5-[(5S)-3,4-dimethyl-1,4-diazabicyclo[3.2.1]oct-2-en-2-yl]-3-methylidene-N-(1,1,1-trifluoropentan-2-yl)penta-1,4-dien-2-amine (PubChem CID 155002007) has the molecular formula C19H28F3N3 and a molecular weight of 355.45 g/mol. Its IUPAC name is (4Z)-5-[(5S)-3,4-dimethyl-1,4-diazabicyclo[3.2.1]oct-2-en-2-yl]-3-methylidene-N-(1,1,1-trifluoropentan-2-yl)penta-1,4-dien-2-amine.
| Compound Name | (4Z)-5-[(5S)-3,4-dimethyl-1,4-diazabicyclo[3.2.1]oct-2-en-2-yl]-3-methylidene-N-(1,1,1-trifluoropentan-2-yl)penta-1,4-dien-2-amine |
|---|---|
| PubChem CID | 155002007 |
| Molecular Formula | C19H28F3N3 |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.22 |
| IUPAC Name | (4Z)-5-[(5S)-3,4-dimethyl-1,4-diazabicyclo[3.2.1]oct-2-en-2-yl]-3-methylidene-N-(1,1,1-trifluoropentan-2-yl)penta-1,4-dien-2-amine |
| SMILES | C=C(/C=C\C1=C(C)N(C)[C@H]2CCN1C2)C(=C)NC(CCC)C(F)(F)F |
| InChI | InChI=1S/C19H28F3N3/c1-6-7-18(19(20,21)22)23-14(3)13(2)8-9-17-15(4)24(5)16-10-11-25(17)12-16/h8-9,16,18,23H,2-3,6-7,10-12H2,1,4-5H3/b9-8-/t16-,18?/m0/s1 |
| InChIKey | BSHRXZHXIDECNT-GITQKFFDSA-N |
| XLogP | 4.18 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|