C22H25F3O3 — CID 143007328
ethyl (E)-3-(2-methyl-4-phenylmethoxycyclohepta-1,3,5-trien-1-yl)prop-2-enoate;1,1,1-trifluoroethane (PubChem CID 143007328) has the molecular formula C22H25F3O3 and a molecular weight of 394.43 g/mol. Its IUPAC name is ethyl (E)-3-(2-methyl-4-phenylmethoxycyclohepta-1,3,5-trien-1-yl)prop-2-enoate;1,1,1-trifluoroethane.
| Compound Name | ethyl (E)-3-(2-methyl-4-phenylmethoxycyclohepta-1,3,5-trien-1-yl)prop-2-enoate;1,1,1-trifluoroethane |
|---|---|
| PubChem CID | 143007328 |
| Molecular Formula | C22H25F3O3 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | ethyl (E)-3-(2-methyl-4-phenylmethoxycyclohepta-1,3,5-trien-1-yl)prop-2-enoate;1,1,1-trifluoroethane |
| SMILES | CC(F)(F)F.CCOC(=O)/C=C/C1=C(C)C=C(OCc2ccccc2)C=CC1 |
| InChI | InChI=1S/C20H22O3.C2H3F3/c1-3-22-20(21)13-12-18-10-7-11-19(14-16(18)2)23-15-17-8-5-4-6-9-17;1-2(3,4)5/h4-9,11-14H,3,10,15H2,1-2H3;1H3/b13-12+; |
| InChIKey | VGXPLFHTAQLAPG-UEIGIMKUSA-N |
| XLogP | 6.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|