C25H34FN5O2 — CID 143008337
1-[3-[(E)-but-3-enylideneamino]oxypropyl]-2-(ethoxymethyl)imidazo[4,5-c]quinolin-4-amine;(E)-3-fluoropent-2-ene (PubChem CID 143008337) has the molecular formula C25H34FN5O2 and a molecular weight of 455.58 g/mol. Its IUPAC name is 1-[3-[(E)-but-3-enylideneamino]oxypropyl]-2-(ethoxymethyl)imidazo[4,5-c]quinolin-4-amine;(E)-3-fluoropent-2-ene.
| Compound Name | 1-[3-[(E)-but-3-enylideneamino]oxypropyl]-2-(ethoxymethyl)imidazo[4,5-c]quinolin-4-amine;(E)-3-fluoropent-2-ene |
|---|---|
| PubChem CID | 143008337 |
| Molecular Formula | C25H34FN5O2 |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.27 |
| IUPAC Name | 1-[3-[(E)-but-3-enylideneamino]oxypropyl]-2-(ethoxymethyl)imidazo[4,5-c]quinolin-4-amine;(E)-3-fluoropent-2-ene |
| SMILES | C/C=C(/F)CC.C=CC/C=N/OCCCn1c(COCC)nc2c(N)nc3ccccc3c21 |
| InChI | InChI=1S/C20H25N5O2.C5H9F/c1-3-5-11-22-27-13-8-12-25-17(14-26-4-2)24-18-19(25)15-9-6-7-10-16(15)23-20(18)21;1-3-5(6)4-2/h3,6-7,9-11H,1,4-5,8,12-14H2,2H3,(H2,21,23);3H,4H2,1-2H3/b22-11+;5-3+ |
| InChIKey | QRDHAWWYOXHYEC-FOCJPXFQSA-N |
| XLogP | 5.94 |
| TPSA | 87.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|