C20H20BrNO2 — CID 143008418
3-bromo-1-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]-4-phenylmethoxypyridin-2-one (PubChem CID 143008418) has the molecular formula C20H20BrNO2 and a molecular weight of 386.29 g/mol. Its IUPAC name is 3-bromo-1-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]-4-phenylmethoxypyridin-2-one.
| Compound Name | 3-bromo-1-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]-4-phenylmethoxypyridin-2-one |
|---|---|
| PubChem CID | 143008418 |
| Molecular Formula | C20H20BrNO2 |
| Molecular Weight | 386.29 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 3-bromo-1-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]-4-phenylmethoxypyridin-2-one |
| SMILES | C=C(/C=C\C=C/C)Cn1ccc(OCc2ccccc2)c(Br)c1=O |
| InChI | InChI=1S/C20H20BrNO2/c1-3-4-6-9-16(2)14-22-13-12-18(19(21)20(22)23)24-15-17-10-7-5-8-11-17/h3-13H,2,14-15H2,1H3/b4-3-,9-6- |
| InChIKey | HBMWFCDJSRPUHM-UBCGXMOYSA-N |
| XLogP | 4.88 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.29 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|