C16H31N5O — CID 143008788
N,N'-diamino-4-[4-(4-aminobutyl)phenoxy]butanimidamide;ethane (PubChem CID 143008788) has the molecular formula C16H31N5O and a molecular weight of 309.46 g/mol. Its IUPAC name is N,N'-diamino-4-[4-(4-aminobutyl)phenoxy]butanimidamide;ethane.
| Compound Name | N,N'-diamino-4-[4-(4-aminobutyl)phenoxy]butanimidamide;ethane |
|---|---|
| PubChem CID | 143008788 |
| Molecular Formula | C16H31N5O |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.25 |
| IUPAC Name | N,N'-diamino-4-[4-(4-aminobutyl)phenoxy]butanimidamide;ethane |
| SMILES | CC.NCCCCc1ccc(OCCC/C(=N/N)NN)cc1 |
| InChI | InChI=1S/C14H25N5O.C2H6/c15-10-2-1-4-12-6-8-13(9-7-12)20-11-3-5-14(18-16)19-17;1-2/h6-9H,1-5,10-11,15-17H2,(H,18,19);1-2H3 |
| InChIKey | RUPASJCJIWQWDT-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|