2-[4-(3-oxo-5,5-diphenylpentyl)piperidin-1-yl]acetic acid

C24H29NO3 — CID 143009281

IUPAC2-[4-(3-oxo-5,5-diphenylpentyl)piperidin-1-yl]acetic acid
SMILESO=C(O)CN1CCC(CCC(=O)CC(c2ccccc2)c2ccccc2)CC1
InChIInChI=1S/C24H29NO3/c26-22(12-11-19-13-15-25(16-14-19)18-24(27)28)17-23(20-7-3-1-4-8-20)21-9-5-2-6-10-21/h1-10,19,23H,11-18H2,(H,27,28)
InChIKeyXZBWSPFPNYTUQX-UHFFFAOYSA-N
MW379.50 g/mol
LogP4.35
Rot. Bonds9

About 2-[4-(3-oxo-5,5-diphenylpentyl)piperidin-1-yl]acetic acid

2-[4-(3-oxo-5,5-diphenylpentyl)piperidin-1-yl]acetic acid (PubChem CID 143009281) has the molecular formula C24H29NO3 and a molecular weight of 379.50 g/mol. Its IUPAC name is 2-[4-(3-oxo-5,5-diphenylpentyl)piperidin-1-yl]acetic acid.

Molecular Properties

Compound Name2-[4-(3-oxo-5,5-diphenylpentyl)piperidin-1-yl]acetic acid
PubChem CID143009281
Molecular FormulaC24H29NO3
Molecular Weight379.50 g/mol
Exact Mass379.21
IUPAC Name2-[4-(3-oxo-5,5-diphenylpentyl)piperidin-1-yl]acetic acid
SMILESO=C(O)CN1CCC(CCC(=O)CC(c2ccccc2)c2ccccc2)CC1
InChIInChI=1S/C24H29NO3/c26-22(12-11-19-13-15-25(16-14-19)18-24(27)28)17-23(20-7-3-1-4-8-20)21-9-5-2-6-10-21/h1-10,19,23H,11-18H2,(H,27,28)
InChIKeyXZBWSPFPNYTUQX-UHFFFAOYSA-N
XLogP4.35
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds9
Heavy Atoms28
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500379.50
LogP ≤ 54.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[4-(3-oxo-5,5-diphenylpentyl)piperidin-1-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-(3-oxo-5,5-diphenylpentyl)piperidin-1-yl]acetic acid?
The IUPAC name of 2-[4-(3-oxo-5,5-diphenylpentyl)piperidin-1-yl]acetic acid (CID 143009281) is 2-[4-(3-oxo-5,5-diphenylpentyl)piperidin-1-yl]acetic acid.
What is the SMILES notation for 2-[4-(3-oxo-5,5-diphenylpentyl)piperidin-1-yl]acetic acid?
The canonical SMILES for 2-[4-(3-oxo-5,5-diphenylpentyl)piperidin-1-yl]acetic acid is O=C(O)CN1CCC(CCC(=O)CC(c2ccccc2)c2ccccc2)CC1.
What is the InChIKey of 2-[4-(3-oxo-5,5-diphenylpentyl)piperidin-1-yl]acetic acid?
The InChIKey is XZBWSPFPNYTUQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29NO3/c26-22(12-11-19-13-15-25(16-14-19)18-24(27)28)17-23(20-7-3-1-4-8-20)21-9-5-2-6-10-21/h1-10,19,23H,11-18H2,(H,27,28).
What are the key properties of 2-[4-(3-oxo-5,5-diphenylpentyl)piperidin-1-yl]acetic acid?
2-[4-(3-oxo-5,5-diphenylpentyl)piperidin-1-yl]acetic acid has a molecular weight of 379.50 g/mol, XLogP of 4.35, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3-oxo-5,5-diphenylpentyl)piperidin-1-yl]acetic acid is sourced from PubChem (CID 143009281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).