C24H29NO3 — CID 143009281
2-[4-(3-oxo-5,5-diphenylpentyl)piperidin-1-yl]acetic acid (PubChem CID 143009281) has the molecular formula C24H29NO3 and a molecular weight of 379.50 g/mol. Its IUPAC name is 2-[4-(3-oxo-5,5-diphenylpentyl)piperidin-1-yl]acetic acid.
| Compound Name | 2-[4-(3-oxo-5,5-diphenylpentyl)piperidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 143009281 |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 2-[4-(3-oxo-5,5-diphenylpentyl)piperidin-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCC(CCC(=O)CC(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C24H29NO3/c26-22(12-11-19-13-15-25(16-14-19)18-24(27)28)17-23(20-7-3-1-4-8-20)21-9-5-2-6-10-21/h1-10,19,23H,11-18H2,(H,27,28) |
| InChIKey | XZBWSPFPNYTUQX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |