About N-cyclohexylacetamide
N-cyclohexylacetamide (PubChem CID 14301) has the molecular formula C8H15NO
and a molecular weight of 141.21 g/mol. Its IUPAC name is N-cyclohexylacetamide.
Molecular Properties
| Compound Name | N-cyclohexylacetamide |
| PubChem CID | 14301 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | N-cyclohexylacetamide |
| SMILES | CC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C8H15NO/c1-7(10)9-8-5-3-2-4-6-8/h8H,2-6H2,1H3,(H,9,10) |
| InChIKey | WRAGCBBWIYQMRF-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-cyclohexylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexylacetamide?
The IUPAC name of N-cyclohexylacetamide (CID 14301) is N-cyclohexylacetamide.
What is the SMILES notation for N-cyclohexylacetamide?
The canonical SMILES for N-cyclohexylacetamide is CC(=O)NC1CCCCC1.
What is the InChIKey of N-cyclohexylacetamide?
The InChIKey is WRAGCBBWIYQMRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO/c1-7(10)9-8-5-3-2-4-6-8/h8H,2-6H2,1H3,(H,9,10).
What are the key properties of N-cyclohexylacetamide?
N-cyclohexylacetamide has a molecular weight of 141.21 g/mol, XLogP of 1.46, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexylacetamide is sourced from PubChem (CID 14301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).