C14H10Cl2N4O2S — CID 143010648
2,3-dichloro-N-(3-methoxypyrido[3,4-b]pyrazin-2-yl)benzenesulfinamide (PubChem CID 143010648) has the molecular formula C14H10Cl2N4O2S and a molecular weight of 369.23 g/mol. Its IUPAC name is 2,3-dichloro-N-(3-methoxypyrido[3,4-b]pyrazin-2-yl)benzenesulfinamide.
| Compound Name | 2,3-dichloro-N-(3-methoxypyrido[3,4-b]pyrazin-2-yl)benzenesulfinamide |
|---|---|
| PubChem CID | 143010648 |
| Molecular Formula | C14H10Cl2N4O2S |
| Molecular Weight | 369.23 g/mol |
| Exact Mass | 367.99 |
| IUPAC Name | 2,3-dichloro-N-(3-methoxypyrido[3,4-b]pyrazin-2-yl)benzenesulfinamide |
| SMILES | COc1nc2cnccc2nc1NS(=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H10Cl2N4O2S/c1-22-14-13(18-9-5-6-17-7-10(9)19-14)20-23(21)11-4-2-3-8(15)12(11)16/h2-7H,1H3,(H,18,20) |
| InChIKey | QQKTXQXWIGSIHN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.23 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |